![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Wellspring-Grant-Letter-affiliation.pdf | 2026-04-13 05:19 | 126K | |
| Water Testing Report.pdf | 2025-11-25 06:15 | 4.8M | |
| Trust Deed-latest.pdf | 2025-11-25 06:15 | 6.1M | |
| Self Cetification.pdf | 2025-11-25 06:15 | 808K | |
| Self Certificate-New.pdf | 2025-11-25 06:15 | 832K | |
| School Management Committee.pdf | 2025-12-03 11:59 | 825K | |
| Recognition Renewal Certificate.pdf | 2025-11-25 06:41 | 2.0M | |
| PTA.pdf | 2025-12-03 11:59 | 778K | |
| NOC Main copy.pdf | 2025-11-25 06:15 | 1.8M | |
| NOC.pdf | 2025-11-25 06:15 | 1.8M | |
| First Recognition.pdf | 2025-11-25 06:15 | 1.5M | |
| Fire Safety-Latest.pdf | 2025-11-25 06:15 | 590K | |
| Fee Structure.pdf | 2025-12-03 11:59 | 1.1M | |
| Drinking Safety Water Certificate.pdf | 2025-11-25 06:41 | 1.1M | |
| DRINKING WATER SAFETY.pdf | 2025-11-25 06:15 | 5.1M | |
| Certificate of land.pdf | 2025-11-25 06:15 | 501K | |
| Certificate of Land Sub Registrar.pdf | 2025-11-25 06:41 | 189K | |
| Building Safety & Stability Certificate.pdf | 2025-11-25 06:15 | 515K | |
| Building Safetry.pdf | 2025-11-25 06:15 | 1.3M | |
| Academic Calender.pdf | 2025-12-03 11:59 | 124K | |